C21H23ClN6 — CID 19139283
6-(4-benzylpiperazin-1-yl)-4-N-(2-chlorophenyl)pyrimidine-4,5-diamine (PubChem CID 19139283) has the molecular formula C21H23ClN6 and a molecular weight of 394.91 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-4-N-(2-chlorophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-4-N-(2-chlorophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19139283 |
| Molecular Formula | C21H23ClN6 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-4-N-(2-chlorophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccccc2Cl)ncnc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23ClN6/c22-17-8-4-5-9-18(17)26-20-19(23)21(25-15-24-20)28-12-10-27(11-13-28)14-16-6-2-1-3-7-16/h1-9,15H,10-14,23H2,(H,24,25,26) |
| InChIKey | HNTJWSKRYJEVAG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |