C19H26N6 — CID 19137255
4-(4-benzylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-5-amine (PubChem CID 19137255) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-5-amine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-5-amine |
|---|---|
| PubChem CID | 19137255 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-6-pyrrolidin-1-ylpyrimidin-5-amine |
| SMILES | Nc1c(N2CCCC2)ncnc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H26N6/c20-17-18(24-8-4-5-9-24)21-15-22-19(17)25-12-10-23(11-13-25)14-16-6-2-1-3-7-16/h1-3,6-7,15H,4-5,8-14,20H2 |
| InChIKey | FZQJOIRJTIAMOH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |