C17H20N6 — CID 44776748
6-(4-benzyl-1,4-diazepan-1-yl)-7H-purine (PubChem CID 44776748) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 6-(4-benzyl-1,4-diazepan-1-yl)-7H-purine.
| Compound Name | 6-(4-benzyl-1,4-diazepan-1-yl)-7H-purine |
|---|---|
| PubChem CID | 44776748 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 6-(4-benzyl-1,4-diazepan-1-yl)-7H-purine |
| SMILES | c1ccc(CN2CCCN(c3ncnc4nc[nH]c34)CC2)cc1 |
| InChI | InChI=1S/C17H20N6/c1-2-5-14(6-3-1)11-22-7-4-8-23(10-9-22)17-15-16(19-12-18-15)20-13-21-17/h1-3,5-6,12-13H,4,7-11H2,(H,18,19,20,21) |
| InChIKey | UNBPADMMMVOXOA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |