C17H23N7S — CID 171334636
4-tert-butyl-2-[[4-(7H-purin-6-yl)piperazin-1-yl]methyl]-1,3-thiazole (PubChem CID 171334636) has the molecular formula C17H23N7S and a molecular weight of 357.49 g/mol. Its IUPAC name is 4-tert-butyl-2-[[4-(7H-purin-6-yl)piperazin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 4-tert-butyl-2-[[4-(7H-purin-6-yl)piperazin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 171334636 |
| Molecular Formula | C17H23N7S |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-tert-butyl-2-[[4-(7H-purin-6-yl)piperazin-1-yl]methyl]-1,3-thiazole |
| SMILES | CC(C)(C)c1csc(CN2CCN(c3ncnc4nc[nH]c34)CC2)n1 |
| InChI | InChI=1S/C17H23N7S/c1-17(2,3)12-9-25-13(22-12)8-23-4-6-24(7-5-23)16-14-15(19-10-18-14)20-11-21-16/h9-11H,4-8H2,1-3H3,(H,18,19,20,21) |
| InChIKey | VZHQCWXGTHXPCL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |