C14H18N8S — CID 71991034
3-ethyl-5-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]-1,2,4-thiadiazole (PubChem CID 71991034) has the molecular formula C14H18N8S and a molecular weight of 330.42 g/mol. Its IUPAC name is 3-ethyl-5-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 71991034 |
| Molecular Formula | C14H18N8S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-ethyl-5-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]-1,2,4-thiadiazole |
| SMILES | CCc1nsc(N2CCCN(c3ncnc4nc[nH]c34)CC2)n1 |
| InChI | InChI=1S/C14H18N8S/c1-2-10-19-14(23-20-10)22-5-3-4-21(6-7-22)13-11-12(16-8-15-11)17-9-18-13/h8-9H,2-7H2,1H3,(H,15,16,17,18) |
| InChIKey | QSTGJJNFMKVVCA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |