C13H19N7S — CID 63342163
2-[4-(7H-purin-6-yl)piperazin-1-yl]butanethioamide (PubChem CID 63342163) has the molecular formula C13H19N7S and a molecular weight of 305.41 g/mol. Its IUPAC name is 2-[4-(7H-purin-6-yl)piperazin-1-yl]butanethioamide.
| Compound Name | 2-[4-(7H-purin-6-yl)piperazin-1-yl]butanethioamide |
|---|---|
| PubChem CID | 63342163 |
| Molecular Formula | C13H19N7S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[4-(7H-purin-6-yl)piperazin-1-yl]butanethioamide |
| SMILES | CCC(C(N)=S)N1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C13H19N7S/c1-2-9(11(14)21)19-3-5-20(6-4-19)13-10-12(16-7-15-10)17-8-18-13/h7-9H,2-6H2,1H3,(H2,14,21)(H,15,16,17,18) |
| InChIKey | VFQBJUIVTWSJHT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|