C15H16N8O — CID 134697631
2-[4-(7H-purin-6-yl)piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 134697631) has the molecular formula C15H16N8O and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-[4-(7H-purin-6-yl)piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[4-(7H-purin-6-yl)piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134697631 |
| Molecular Formula | C15H16N8O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[4-(7H-purin-6-yl)piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C15H16N8O/c16-12(24)10-2-1-3-17-14(10)22-4-6-23(7-5-22)15-11-13(19-8-18-11)20-9-21-15/h1-3,8-9H,4-7H2,(H2,16,24)(H,18,19,20,21) |
| InChIKey | IZVJHKMURBECFP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |