C18H16N6O2 — CID 42535118
1-benzofuran-2-yl-[4-(7H-purin-6-yl)piperazin-1-yl]methanone (PubChem CID 42535118) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[4-(7H-purin-6-yl)piperazin-1-yl]methanone.
| Compound Name | 1-benzofuran-2-yl-[4-(7H-purin-6-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42535118 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-benzofuran-2-yl-[4-(7H-purin-6-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C18H16N6O2/c25-18(14-9-12-3-1-2-4-13(12)26-14)24-7-5-23(6-8-24)17-15-16(20-10-19-15)21-11-22-17/h1-4,9-11H,5-8H2,(H,19,20,21,22) |
| InChIKey | JDHSMSRECVPBTQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |