C15H16N6OS — CID 51087667
[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]-thiophen-3-ylmethanone (PubChem CID 51087667) has the molecular formula C15H16N6OS and a molecular weight of 328.40 g/mol. Its IUPAC name is [4-(7H-purin-6-yl)-1,4-diazepan-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [4-(7H-purin-6-yl)-1,4-diazepan-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 51087667 |
| Molecular Formula | C15H16N6OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [4-(7H-purin-6-yl)-1,4-diazepan-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C15H16N6OS/c22-15(11-2-7-23-8-11)21-4-1-3-20(5-6-21)14-12-13(17-9-16-12)18-10-19-14/h2,7-10H,1,3-6H2,(H,16,17,18,19) |
| InChIKey | YKGKAUAPCXJQJG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |