C14H18N6O — CID 133499116
cyclopropyl-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 133499116) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is cyclopropyl-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 133499116 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | cyclopropyl-[4-(7H-purin-6-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C14H18N6O/c21-14(10-2-3-10)20-5-1-4-19(6-7-20)13-11-12(16-8-15-11)17-9-18-13/h8-10H,1-7H2,(H,15,16,17,18) |
| InChIKey | GCWNSLYPWLABPB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |