C10H14N6 — CID 3702788
6-(1,4-diazepan-1-yl)-7H-purine (PubChem CID 3702788) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-(1,4-diazepan-1-yl)-7H-purine.
| Compound Name | 6-(1,4-diazepan-1-yl)-7H-purine |
|---|---|
| PubChem CID | 3702788 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-(1,4-diazepan-1-yl)-7H-purine |
| SMILES | c1nc(N2CCCNCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H14N6/c1-2-11-3-5-16(4-1)10-8-9(13-6-12-8)14-7-15-10/h6-7,11H,1-5H2,(H,12,13,14,15) |
| InChIKey | LRKGCGBJAGYLHN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |