C12H15N5 — CID 133481023
6-(5-azaspiro[2.5]octan-5-yl)-7H-purine (PubChem CID 133481023) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 6-(5-azaspiro[2.5]octan-5-yl)-7H-purine.
| Compound Name | 6-(5-azaspiro[2.5]octan-5-yl)-7H-purine |
|---|---|
| PubChem CID | 133481023 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 6-(5-azaspiro[2.5]octan-5-yl)-7H-purine |
| SMILES | c1nc(N2CCCC3(CC3)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H15N5/c1-2-12(3-4-12)6-17(5-1)11-9-10(14-7-13-9)15-8-16-11/h7-8H,1-6H2,(H,13,14,15,16) |
| InChIKey | NAVMTUMHWVQSOW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |