C18H17F2N5O2 — CID 56872262
3-[(2,4-difluorophenyl)methyl]-1-(7H-purin-6-yl)piperidine-3-carboxylic acid (PubChem CID 56872262) has the molecular formula C18H17F2N5O2 and a molecular weight of 373.36 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-1-(7H-purin-6-yl)piperidine-3-carboxylic acid.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-1-(7H-purin-6-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 56872262 |
| Molecular Formula | C18H17F2N5O2 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-1-(7H-purin-6-yl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1(Cc2ccc(F)cc2F)CCCN(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C18H17F2N5O2/c19-12-3-2-11(13(20)6-12)7-18(17(26)27)4-1-5-25(8-18)16-14-15(22-9-21-14)23-10-24-16/h2-3,6,9-10H,1,4-5,7-8H2,(H,26,27)(H,21,22,23,24) |
| InChIKey | SUJJACXPMSWFLD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |