C13H17N5O2 — CID 106977510
2-propyl-1-(7H-purin-6-yl)pyrrolidine-2-carboxylic acid (PubChem CID 106977510) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-propyl-1-(7H-purin-6-yl)pyrrolidine-2-carboxylic acid.
| Compound Name | 2-propyl-1-(7H-purin-6-yl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 106977510 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-propyl-1-(7H-purin-6-yl)pyrrolidine-2-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCCN1c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C13H17N5O2/c1-2-4-13(12(19)20)5-3-6-18(13)11-9-10(15-7-14-9)16-8-17-11/h7-8H,2-6H2,1H3,(H,19,20)(H,14,15,16,17) |
| InChIKey | SRKRNOPKRKKQSH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |