C20H25N5O — CID 95222493
[(3R)-3-(3-phenylpropyl)-1-(7H-purin-6-yl)piperidin-3-yl]methanol (PubChem CID 95222493) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is [(3R)-3-(3-phenylpropyl)-1-(7H-purin-6-yl)piperidin-3-yl]methanol.
| Compound Name | [(3R)-3-(3-phenylpropyl)-1-(7H-purin-6-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 95222493 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | [(3R)-3-(3-phenylpropyl)-1-(7H-purin-6-yl)piperidin-3-yl]methanol |
| SMILES | OC[C@]1(CCCc2ccccc2)CCCN(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C20H25N5O/c26-13-20(9-4-8-16-6-2-1-3-7-16)10-5-11-25(12-20)19-17-18(22-14-21-17)23-15-24-19/h1-3,6-7,14-15,26H,4-5,8-13H2,(H,21,22,23,24)/t20-/m1/s1 |
| InChIKey | LWNYYCMWVFYQMX-HXUWFJFHSA-N |
| XLogP | 2.95 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |