C21H25N3O — CID 95226937
2-[(3R)-3-(hydroxymethyl)-3-(3-phenylpropyl)piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 95226937) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(3R)-3-(hydroxymethyl)-3-(3-phenylpropyl)piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[(3R)-3-(hydroxymethyl)-3-(3-phenylpropyl)piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 95226937 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[(3R)-3-(hydroxymethyl)-3-(3-phenylpropyl)piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCC[C@](CO)(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C21H25N3O/c22-15-19-10-5-13-23-20(19)24-14-6-12-21(16-24,17-25)11-4-9-18-7-2-1-3-8-18/h1-3,5,7-8,10,13,25H,4,6,9,11-12,14,16-17H2/t21-/m1/s1 |
| InChIKey | KYKLPLQEWFBGHY-OAQYLSRUSA-N |
| XLogP | 3.56 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |