C18H24N4O — CID 95208187
[(3S)-1-(4-aminopyrimidin-2-yl)-3-(2-phenylethyl)piperidin-3-yl]methanol (PubChem CID 95208187) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is [(3S)-1-(4-aminopyrimidin-2-yl)-3-(2-phenylethyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-(4-aminopyrimidin-2-yl)-3-(2-phenylethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 95208187 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [(3S)-1-(4-aminopyrimidin-2-yl)-3-(2-phenylethyl)piperidin-3-yl]methanol |
| SMILES | Nc1ccnc(N2CCC[C@@](CO)(CCc3ccccc3)C2)n1 |
| InChI | InChI=1S/C18H24N4O/c19-16-8-11-20-17(21-16)22-12-4-9-18(13-22,14-23)10-7-15-5-2-1-3-6-15/h1-3,5-6,8,11,23H,4,7,9-10,12-14H2,(H2,19,20,21)/t18-/m1/s1 |
| InChIKey | BKRPCNBMFGYXOM-GOSISDBHSA-N |
| XLogP | 2.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |