C18H22N4O3 — CID 56872755
1-(4-aminopyrimidin-2-yl)-3-(2-phenoxyethyl)piperidine-3-carboxylic acid (PubChem CID 56872755) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-(4-aminopyrimidin-2-yl)-3-(2-phenoxyethyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(4-aminopyrimidin-2-yl)-3-(2-phenoxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 56872755 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-(4-aminopyrimidin-2-yl)-3-(2-phenoxyethyl)piperidine-3-carboxylic acid |
| SMILES | Nc1ccnc(N2CCCC(CCOc3ccccc3)(C(=O)O)C2)n1 |
| InChI | InChI=1S/C18H22N4O3/c19-15-7-10-20-17(21-15)22-11-4-8-18(13-22,16(23)24)9-12-25-14-5-2-1-3-6-14/h1-3,5-7,10H,4,8-9,11-13H2,(H,23,24)(H2,19,20,21) |
| InChIKey | IPVYDFWLFJJURA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |