C16H25N3O3 — CID 97121048
(3S)-1-(4-ethyl-5-methylpyrimidin-2-yl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid (PubChem CID 97121048) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3S)-1-(4-ethyl-5-methylpyrimidin-2-yl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(4-ethyl-5-methylpyrimidin-2-yl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97121048 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3S)-1-(4-ethyl-5-methylpyrimidin-2-yl)-3-(2-methoxyethyl)piperidine-3-carboxylic acid |
| SMILES | CCc1nc(N2CCC[C@@](CCOC)(C(=O)O)C2)ncc1C |
| InChI | InChI=1S/C16H25N3O3/c1-4-13-12(2)10-17-15(18-13)19-8-5-6-16(11-19,14(20)21)7-9-22-3/h10H,4-9,11H2,1-3H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | IPUQJJPKZDVUBX-INIZCTEOSA-N |
| XLogP | 2.06 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |