C20H25N3O2S — CID 45220389
1-[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]-2-pyrimidin-2-ylsulfanylethanone (PubChem CID 45220389) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]-2-pyrimidin-2-ylsulfanylethanone.
| Compound Name | 1-[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]-2-pyrimidin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 45220389 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]-2-pyrimidin-2-ylsulfanylethanone |
| SMILES | O=C(CSc1ncccn1)N1CCCC(CO)(CCc2ccccc2)C1 |
| InChI | InChI=1S/C20H25N3O2S/c24-16-20(10-8-17-6-2-1-3-7-17)9-4-13-23(15-20)18(25)14-26-19-21-11-5-12-22-19/h1-3,5-7,11-12,24H,4,8-10,13-16H2 |
| InChIKey | BBNKRVWFHGTJQJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |