C19H23NO2S — CID 45180792
[3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 45180792) has the molecular formula C19H23NO2S and a molecular weight of 329.46 g/mol. Its IUPAC name is [3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 45180792 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [3-(hydroxymethyl)-3-(2-phenylethyl)piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCCC(CO)(CCc2ccccc2)C1 |
| InChI | InChI=1S/C19H23NO2S/c21-15-19(10-7-16-5-2-1-3-6-16)9-4-11-20(14-19)18(22)17-8-12-23-13-17/h1-3,5-6,8,12-13,21H,4,7,9-11,14-15H2 |
| InChIKey | UMMLEAXWRDLCFP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |