C20H26N4OS — CID 45202124
1-[3-[methyl(2-phenylethyl)amino]piperidin-1-yl]-2-pyrimidin-2-ylsulfanylethanone (PubChem CID 45202124) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[3-[methyl(2-phenylethyl)amino]piperidin-1-yl]-2-pyrimidin-2-ylsulfanylethanone.
| Compound Name | 1-[3-[methyl(2-phenylethyl)amino]piperidin-1-yl]-2-pyrimidin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 45202124 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[3-[methyl(2-phenylethyl)amino]piperidin-1-yl]-2-pyrimidin-2-ylsulfanylethanone |
| SMILES | CN(CCc1ccccc1)C1CCCN(C(=O)CSc2ncccn2)C1 |
| InChI | InChI=1S/C20H26N4OS/c1-23(14-10-17-7-3-2-4-8-17)18-9-5-13-24(15-18)19(25)16-26-20-21-11-6-12-22-20/h2-4,6-8,11-12,18H,5,9-10,13-16H2,1H3 |
| InChIKey | AEHCREPFHQUBLJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |