C21H35N5O — CID 45179784
2-(4-ethylpiperazin-1-yl)-1-[3-[methyl(2-pyridin-2-ylethyl)amino]piperidin-1-yl]ethanone (PubChem CID 45179784) has the molecular formula C21H35N5O and a molecular weight of 373.55 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-1-[3-[methyl(2-pyridin-2-ylethyl)amino]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-1-[3-[methyl(2-pyridin-2-ylethyl)amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 45179784 |
| Molecular Formula | C21H35N5O |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-1-[3-[methyl(2-pyridin-2-ylethyl)amino]piperidin-1-yl]ethanone |
| SMILES | CCN1CCN(CC(=O)N2CCCC(N(C)CCc3ccccn3)C2)CC1 |
| InChI | InChI=1S/C21H35N5O/c1-3-24-13-15-25(16-14-24)18-21(27)26-11-6-8-20(17-26)23(2)12-9-19-7-4-5-10-22-19/h4-5,7,10,20H,3,6,8-9,11-18H2,1-2H3 |
| InChIKey | SPKVLVJMGDMDQB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 42.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |