C21H27N3O2S — CID 42396448
(3S)-N-methyl-1-[(E)-2-phenylethenyl]sulfonyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine (PubChem CID 42396448) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is (3S)-N-methyl-1-[(E)-2-phenylethenyl]sulfonyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine.
| Compound Name | (3S)-N-methyl-1-[(E)-2-phenylethenyl]sulfonyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 42396448 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (3S)-N-methyl-1-[(E)-2-phenylethenyl]sulfonyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine |
| SMILES | CN(CCc1ccccn1)[C@H]1CCCN(S(=O)(=O)/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C21H27N3O2S/c1-23(16-12-20-10-5-6-14-22-20)21-11-7-15-24(18-21)27(25,26)17-13-19-8-3-2-4-9-19/h2-6,8-10,13-14,17,21H,7,11-12,15-16,18H2,1H3/b17-13+/t21-/m0/s1 |
| InChIKey | PSIBAODWWQAALV-ZDJZVTAXSA-N |
| XLogP | 3.02 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |