C21H29N3O3S — CID 45208601
1-(2-methoxy-5-methylphenyl)sulfonyl-N-methyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine (PubChem CID 45208601) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)sulfonyl-N-methyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine.
| Compound Name | 1-(2-methoxy-5-methylphenyl)sulfonyl-N-methyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 45208601 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)sulfonyl-N-methyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCCC(N(C)CCc2ccccn2)C1 |
| InChI | InChI=1S/C21H29N3O3S/c1-17-9-10-20(27-3)21(15-17)28(25,26)24-13-6-8-19(16-24)23(2)14-11-18-7-4-5-12-22-18/h4-5,7,9-10,12,15,19H,6,8,11,13-14,16H2,1-3H3 |
| InChIKey | IYKDLTUSZDISKO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |