C22H30N2O3S — CID 42244156
(3S)-1-(2-methoxy-5-methylphenyl)sulfonyl-N-methyl-N-(2-phenylethyl)piperidin-3-amine (PubChem CID 42244156) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is (3S)-1-(2-methoxy-5-methylphenyl)sulfonyl-N-methyl-N-(2-phenylethyl)piperidin-3-amine.
| Compound Name | (3S)-1-(2-methoxy-5-methylphenyl)sulfonyl-N-methyl-N-(2-phenylethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 42244156 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (3S)-1-(2-methoxy-5-methylphenyl)sulfonyl-N-methyl-N-(2-phenylethyl)piperidin-3-amine |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCC[C@H](N(C)CCc2ccccc2)C1 |
| InChI | InChI=1S/C22H30N2O3S/c1-18-11-12-21(27-3)22(16-18)28(25,26)24-14-7-10-20(17-24)23(2)15-13-19-8-5-4-6-9-19/h4-6,8-9,11-12,16,20H,7,10,13-15,17H2,1-3H3/t20-/m0/s1 |
| InChIKey | ZYMIMCMUMXGBNB-FQEVSTJZSA-N |
| XLogP | 3.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |