C19H25N3O2S — CID 42521946
(3R)-1-(benzenesulfonyl)-N-methyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine (PubChem CID 42521946) has the molecular formula C19H25N3O2S and a molecular weight of 359.49 g/mol. Its IUPAC name is (3R)-1-(benzenesulfonyl)-N-methyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine.
| Compound Name | (3R)-1-(benzenesulfonyl)-N-methyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 42521946 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3R)-1-(benzenesulfonyl)-N-methyl-N-(2-pyridin-2-ylethyl)piperidin-3-amine |
| SMILES | CN(CCc1ccccn1)[C@@H]1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C19H25N3O2S/c1-21(15-12-17-8-5-6-13-20-17)18-9-7-14-22(16-18)25(23,24)19-10-3-2-4-11-19/h2-6,8,10-11,13,18H,7,9,12,14-16H2,1H3/t18-/m1/s1 |
| InChIKey | LXEIUEQKIRELLK-GOSISDBHSA-N |
| XLogP | 2.41 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |