C12H18N2O2S — CID 141202657
(3S)-1-(benzenesulfonyl)-N,N-dimethylpyrrolidin-3-amine (PubChem CID 141202657) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is (3S)-1-(benzenesulfonyl)-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | (3S)-1-(benzenesulfonyl)-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 141202657 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (3S)-1-(benzenesulfonyl)-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)[C@H]1CCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C12H18N2O2S/c1-13(2)11-8-9-14(10-11)17(15,16)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | AKOUYNQSJOEWFS-NSHDSACASA-N |
| XLogP | 1.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |