C15H19N3O3S — CID 11950765
4-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-2H-isoquinolin-1-one (PubChem CID 11950765) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-2H-isoquinolin-1-one.
| Compound Name | 4-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 11950765 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-2H-isoquinolin-1-one |
| SMILES | CN(C)[C@H]1CCN(S(=O)(=O)c2c[nH]c(=O)c3ccccc23)C1 |
| InChI | InChI=1S/C15H19N3O3S/c1-17(2)11-7-8-18(10-11)22(20,21)14-9-16-15(19)13-6-4-3-5-12(13)14/h3-6,9,11H,7-8,10H2,1-2H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | SCTRJSHSPLGROY-NSHDSACASA-N |
| XLogP | 0.85 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |