C13H14ClN3O3S — CID 67242547
5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-chloro-2H-isoquinolin-1-one (PubChem CID 67242547) has the molecular formula C13H14ClN3O3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-chloro-2H-isoquinolin-1-one.
| Compound Name | 5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-chloro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 67242547 |
| Molecular Formula | C13H14ClN3O3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-chloro-2H-isoquinolin-1-one |
| SMILES | N[C@H]1CCN(S(=O)(=O)c2cccc3c(=O)[nH]cc(Cl)c23)C1 |
| InChI | InChI=1S/C13H14ClN3O3S/c14-10-6-16-13(18)9-2-1-3-11(12(9)10)21(19,20)17-5-4-8(15)7-17/h1-3,6,8H,4-5,7,15H2,(H,16,18)/t8-/m0/s1 |
| InChIKey | PIHHOGQNYJMNHH-QMMMGPOBSA-N |
| XLogP | 0.90 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |