C18H18BrN3O4S — CID 67242815
4-bromo-5-[(3R)-3-[furan-2-yl(methyl)amino]pyrrolidin-1-yl]sulfonyl-2H-isoquinolin-1-one (PubChem CID 67242815) has the molecular formula C18H18BrN3O4S and a molecular weight of 452.33 g/mol. Its IUPAC name is 4-bromo-5-[(3R)-3-[furan-2-yl(methyl)amino]pyrrolidin-1-yl]sulfonyl-2H-isoquinolin-1-one.
| Compound Name | 4-bromo-5-[(3R)-3-[furan-2-yl(methyl)amino]pyrrolidin-1-yl]sulfonyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 67242815 |
| Molecular Formula | C18H18BrN3O4S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 4-bromo-5-[(3R)-3-[furan-2-yl(methyl)amino]pyrrolidin-1-yl]sulfonyl-2H-isoquinolin-1-one |
| SMILES | CN(c1ccco1)[C@@H]1CCN(S(=O)(=O)c2cccc3c(=O)[nH]cc(Br)c23)C1 |
| InChI | InChI=1S/C18H18BrN3O4S/c1-21(16-6-3-9-26-16)12-7-8-22(11-12)27(24,25)15-5-2-4-13-17(15)14(19)10-20-18(13)23/h2-6,9-10,12H,7-8,11H2,1H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | ZHLYRUSGBAODDU-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |