C14H16FN3O3S — CID 70195371
5-(1,4-diazepan-1-ylsulfonyl)-4-fluoro-2H-isoquinolin-1-one (PubChem CID 70195371) has the molecular formula C14H16FN3O3S and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)-4-fluoro-2H-isoquinolin-1-one.
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)-4-fluoro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 70195371 |
| Molecular Formula | C14H16FN3O3S |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)-4-fluoro-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]cc(F)c2c(S(=O)(=O)N3CCCNCC3)cccc12 |
| InChI | InChI=1S/C14H16FN3O3S/c15-11-9-17-14(19)10-3-1-4-12(13(10)11)22(20,21)18-7-2-5-16-6-8-18/h1,3-4,9,16H,2,5-8H2,(H,17,19) |
| InChIKey | GCYHAAMZNUKYFG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |