C14H18ClN3O2S — CID 119963237
5-(1,4-diazepan-1-ylsulfonyl)quinoline;hydrochloride (PubChem CID 119963237) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)quinoline;hydrochloride.
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)quinoline;hydrochloride |
|---|---|
| PubChem CID | 119963237 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)quinoline;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc2ncccc12)N1CCCNCC1 |
| InChI | InChI=1S/C14H17N3O2S.ClH/c18-20(19,17-10-3-7-15-9-11-17)14-6-1-5-13-12(14)4-2-8-16-13;/h1-2,4-6,8,15H,3,7,9-11H2;1H |
| InChIKey | UTWNHJXBOGPTBB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |