C10H15N3O2S — CID 86784566
1-pyridin-2-ylsulfonyl-1,4-diazepane (PubChem CID 86784566) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 1-pyridin-2-ylsulfonyl-1,4-diazepane.
| Compound Name | 1-pyridin-2-ylsulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 86784566 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-pyridin-2-ylsulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1ccccn1)N1CCCNCC1 |
| InChI | InChI=1S/C10H15N3O2S/c14-16(15,10-4-1-2-6-12-10)13-8-3-5-11-7-9-13/h1-2,4,6,11H,3,5,7-9H2 |
| InChIKey | QEOQUBGQERVAGI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |