C10H15N3O2S — CID 86331837
(3S)-1-pyridin-2-ylsulfonylpiperidin-3-amine (PubChem CID 86331837) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is (3S)-1-pyridin-2-ylsulfonylpiperidin-3-amine.
| Compound Name | (3S)-1-pyridin-2-ylsulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 86331837 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (3S)-1-pyridin-2-ylsulfonylpiperidin-3-amine |
| SMILES | N[C@H]1CCCN(S(=O)(=O)c2ccccn2)C1 |
| InChI | InChI=1S/C10H15N3O2S/c11-9-4-3-7-13(8-9)16(14,15)10-5-1-2-6-12-10/h1-2,5-6,9H,3-4,7-8,11H2/t9-/m0/s1 |
| InChIKey | YMIGTPHKBAWZJV-VIFPVBQESA-N |
| XLogP | 0.19 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |