C9H14ClN3O2S — CID 91660222
1-pyridin-2-ylsulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 91660222) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is 1-pyridin-2-ylsulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-pyridin-2-ylsulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 91660222 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-pyridin-2-ylsulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(S(=O)(=O)c2ccccn2)C1 |
| InChI | InChI=1S/C9H13N3O2S.ClH/c10-8-4-6-12(7-8)15(13,14)9-3-1-2-5-11-9;/h1-3,5,8H,4,6-7,10H2;1H |
| InChIKey | PWRMERTYFKBOAG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |