C11H17N3O2S — CID 115275215
2,2-dimethyl-1-pyridin-2-ylsulfonylpyrrolidin-3-amine (PubChem CID 115275215) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2,2-dimethyl-1-pyridin-2-ylsulfonylpyrrolidin-3-amine.
| Compound Name | 2,2-dimethyl-1-pyridin-2-ylsulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115275215 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2,2-dimethyl-1-pyridin-2-ylsulfonylpyrrolidin-3-amine |
| SMILES | CC1(C)C(N)CCN1S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C11H17N3O2S/c1-11(2)9(12)6-8-14(11)17(15,16)10-5-3-4-7-13-10/h3-5,7,9H,6,8,12H2,1-2H3 |
| InChIKey | XGLXRBHDTZEAOU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |