About cyclobutane;pyridine-2-sulfonamide
cyclobutane;pyridine-2-sulfonamide (PubChem CID 175429056) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is cyclobutane;pyridine-2-sulfonamide.
Molecular Properties
| Compound Name | cyclobutane;pyridine-2-sulfonamide |
| PubChem CID | 175429056 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | cyclobutane;pyridine-2-sulfonamide |
| SMILES | C1CCC1.NS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C5H6N2O2S.C4H8/c6-10(8,9)5-3-1-2-4-7-5;1-2-4-3-1/h1-4H,(H2,6,8,9);1-4H2 |
| InChIKey | BECTWVGOGJTPQG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutane;pyridine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;pyridine-2-sulfonamide?
The IUPAC name of cyclobutane;pyridine-2-sulfonamide (CID 175429056) is cyclobutane;pyridine-2-sulfonamide.
What is the SMILES notation for cyclobutane;pyridine-2-sulfonamide?
The canonical SMILES for cyclobutane;pyridine-2-sulfonamide is C1CCC1.NS(=O)(=O)c1ccccn1.
What is the InChIKey of cyclobutane;pyridine-2-sulfonamide?
The InChIKey is BECTWVGOGJTPQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S.C4H8/c6-10(8,9)5-3-1-2-4-7-5;1-2-4-3-1/h1-4H,(H2,6,8,9);1-4H2.
What are the key properties of cyclobutane;pyridine-2-sulfonamide?
cyclobutane;pyridine-2-sulfonamide has a molecular weight of 214.29 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;pyridine-2-sulfonamide is sourced from PubChem (CID 175429056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).