About 2-methylpropane;pyridine-2-sulfonic acid
2-methylpropane;pyridine-2-sulfonic acid (PubChem CID 174713168) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-methylpropane;pyridine-2-sulfonic acid.
Molecular Properties
| Compound Name | 2-methylpropane;pyridine-2-sulfonic acid |
| PubChem CID | 174713168 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2-methylpropane;pyridine-2-sulfonic acid |
| SMILES | CC(C)C.O=S(=O)(O)c1ccccn1 |
| InChI | InChI=1S/C5H5NO3S.C4H10/c7-10(8,9)5-3-1-2-4-6-5;1-4(2)3/h1-4H,(H,7,8,9);4H,1-3H3 |
| InChIKey | NFHVIESXLISLIH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;pyridine-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;pyridine-2-sulfonic acid?
The IUPAC name of 2-methylpropane;pyridine-2-sulfonic acid (CID 174713168) is 2-methylpropane;pyridine-2-sulfonic acid.
What is the SMILES notation for 2-methylpropane;pyridine-2-sulfonic acid?
The canonical SMILES for 2-methylpropane;pyridine-2-sulfonic acid is CC(C)C.O=S(=O)(O)c1ccccn1.
What is the InChIKey of 2-methylpropane;pyridine-2-sulfonic acid?
The InChIKey is NFHVIESXLISLIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3S.C4H10/c7-10(8,9)5-3-1-2-4-6-5;1-4(2)3/h1-4H,(H,7,8,9);4H,1-3H3.
What are the key properties of 2-methylpropane;pyridine-2-sulfonic acid?
2-methylpropane;pyridine-2-sulfonic acid has a molecular weight of 217.29 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;pyridine-2-sulfonic acid is sourced from PubChem (CID 174713168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).