C8H14N4O4S — CID 70436230
2-(1-pyridin-2-ylethyl)guanidine;sulfuric acid (PubChem CID 70436230) has the molecular formula C8H14N4O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-(1-pyridin-2-ylethyl)guanidine;sulfuric acid.
| Compound Name | 2-(1-pyridin-2-ylethyl)guanidine;sulfuric acid |
|---|---|
| PubChem CID | 70436230 |
| Molecular Formula | C8H14N4O4S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-(1-pyridin-2-ylethyl)guanidine;sulfuric acid |
| SMILES | CC(N=C(N)N)c1ccccn1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H12N4.H2O4S/c1-6(12-8(9)10)7-4-2-3-5-11-7;1-5(2,3)4/h2-6H,1H3,(H4,9,10,12);(H2,1,2,3,4) |
| InChIKey | KPROXSQLSKYXDK-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|