C7H12N4O4S — CID 13371455
2-(pyridin-2-ylmethyl)guanidine;sulfuric acid (PubChem CID 13371455) has the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-(pyridin-2-ylmethyl)guanidine;sulfuric acid.
| Compound Name | 2-(pyridin-2-ylmethyl)guanidine;sulfuric acid |
|---|---|
| PubChem CID | 13371455 |
| Molecular Formula | C7H12N4O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-(pyridin-2-ylmethyl)guanidine;sulfuric acid |
| SMILES | NC(N)=NCc1ccccn1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H10N4.H2O4S/c8-7(9)11-5-6-3-1-2-4-10-6;1-5(2,3)4/h1-4H,5H2,(H4,8,9,11);(H2,1,2,3,4) |
| InChIKey | XDNWWNJGHXLXRL-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|