C17H22N4O2S — CID 90831382
2-(benzenesulfonamido)-3-methyl-N'-(pyridin-2-ylmethyl)butanimidamide (PubChem CID 90831382) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-methyl-N'-(pyridin-2-ylmethyl)butanimidamide.
| Compound Name | 2-(benzenesulfonamido)-3-methyl-N'-(pyridin-2-ylmethyl)butanimidamide |
|---|---|
| PubChem CID | 90831382 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(benzenesulfonamido)-3-methyl-N'-(pyridin-2-ylmethyl)butanimidamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)/C(N)=N/Cc1ccccn1 |
| InChI | InChI=1S/C17H22N4O2S/c1-13(2)16(17(18)20-12-14-8-6-7-11-19-14)21-24(22,23)15-9-4-3-5-10-15/h3-11,13,16,21H,12H2,1-2H3,(H2,18,20) |
| InChIKey | DCXYROYRFIMPMJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|