C23H24N2O5S — CID 57390232
(2R)-3-methyl-2-[[4-[4-(pyridin-2-ylmethoxy)phenyl]phenyl]sulfonylamino]butanoic acid (PubChem CID 57390232) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[4-[4-(pyridin-2-ylmethoxy)phenyl]phenyl]sulfonylamino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[4-[4-(pyridin-2-ylmethoxy)phenyl]phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 57390232 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | (2R)-3-methyl-2-[[4-[4-(pyridin-2-ylmethoxy)phenyl]phenyl]sulfonylamino]butanoic acid |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccc(-c2ccc(OCc3ccccn3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H24N2O5S/c1-16(2)22(23(26)27)25-31(28,29)21-12-8-18(9-13-21)17-6-10-20(11-7-17)30-15-19-5-3-4-14-24-19/h3-14,16,22,25H,15H2,1-2H3,(H,26,27)/t22-/m1/s1 |
| InChIKey | ZTPRFZPZTSRGJM-JOCHJYFZSA-N |
| XLogP | 3.72 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |