C31H34N2O5S — CID 67110207
tert-butyl 3-methyl-2-[[4-[4-(quinolin-2-ylmethoxy)phenyl]phenyl]sulfonylamino]butanoate (PubChem CID 67110207) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is tert-butyl 3-methyl-2-[[4-[4-(quinolin-2-ylmethoxy)phenyl]phenyl]sulfonylamino]butanoate.
| Compound Name | tert-butyl 3-methyl-2-[[4-[4-(quinolin-2-ylmethoxy)phenyl]phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 67110207 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | tert-butyl 3-methyl-2-[[4-[4-(quinolin-2-ylmethoxy)phenyl]phenyl]sulfonylamino]butanoate |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(-c2ccc(OCc3ccc4ccccc4n3)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H34N2O5S/c1-21(2)29(30(34)38-31(3,4)5)33-39(35,36)27-18-13-23(14-19-27)22-11-16-26(17-12-22)37-20-25-15-10-24-8-6-7-9-28(24)32-25/h6-19,21,29,33H,20H2,1-5H3 |
| InChIKey | QDPBTFHQPVVOBM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |