C31H33N2O5S- — CID 91166713
2-[[4-[4-[[3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-sulfinatoamino]phenyl]phenoxy]methyl]quinoline (PubChem CID 91166713) has the molecular formula C31H33N2O5S- and a molecular weight of 545.68 g/mol. Its IUPAC name is 2-[[4-[4-[[3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-sulfinatoamino]phenyl]phenoxy]methyl]quinoline.
| Compound Name | 2-[[4-[4-[[3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-sulfinatoamino]phenyl]phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 91166713 |
| Molecular Formula | C31H33N2O5S- |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 2-[[4-[4-[[3-methyl-1-[(2-methylpropan-2-yl)oxy]-1-oxobutan-2-yl]-sulfinatoamino]phenyl]phenoxy]methyl]quinoline |
| SMILES | CC(C)C(C(=O)OC(C)(C)C)N(c1ccc(-c2ccc(OCc3ccc4ccccc4n3)cc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C31H34N2O5S/c1-21(2)29(30(34)38-31(3,4)5)33(39(35)36)26-16-11-22(12-17-26)23-13-18-27(19-14-23)37-20-25-15-10-24-8-6-7-9-28(24)32-25/h6-19,21,29H,20H2,1-5H3,(H,35,36)/p-1 |
| InChIKey | LIBJXCVWAFGEAZ-UHFFFAOYSA-M |
| XLogP | 6.45 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|