C37H33N2NaO5 — CID 23664501
sodium;4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]pentanoate;hydrate (PubChem CID 23664501) has the molecular formula C37H33N2NaO5 and a molecular weight of 608.67 g/mol. Its IUPAC name is sodium;4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]pentanoate;hydrate.
| Compound Name | sodium;4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]pentanoate;hydrate |
|---|---|
| PubChem CID | 23664501 |
| Molecular Formula | C37H33N2NaO5 |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | sodium;4,4-bis[4-(quinolin-2-ylmethoxy)phenyl]pentanoate;hydrate |
| SMILES | CC(CCC(=O)[O-])(c1ccc(OCc2ccc3ccccc3n2)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1.O.[Na+] |
| InChI | InChI=1S/C37H32N2O4.Na.H2O/c1-37(23-22-36(40)41,28-12-18-32(19-13-28)42-24-30-16-10-26-6-2-4-8-34(26)38-30)29-14-20-33(21-15-29)43-25-31-17-11-27-7-3-5-9-35(27)39-31;;/h2-21H,22-25H2,1H3,(H,40,41);;1H2/q;+1;/p-1 |
| InChIKey | RGFRZGIQLAQIGO-UHFFFAOYSA-M |
| XLogP | 2.96 |
| TPSA | 115.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |