C38H34N2O3S — CID 19069071
S-ethyl 3,3-bis[4-(quinolin-2-ylmethoxy)phenyl]butanethioate (PubChem CID 19069071) has the molecular formula C38H34N2O3S and a molecular weight of 598.77 g/mol. Its IUPAC name is S-ethyl 3,3-bis[4-(quinolin-2-ylmethoxy)phenyl]butanethioate.
| Compound Name | S-ethyl 3,3-bis[4-(quinolin-2-ylmethoxy)phenyl]butanethioate |
|---|---|
| PubChem CID | 19069071 |
| Molecular Formula | C38H34N2O3S |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | S-ethyl 3,3-bis[4-(quinolin-2-ylmethoxy)phenyl]butanethioate |
| SMILES | CCSC(=O)CC(C)(c1ccc(OCc2ccc3ccccc3n2)cc1)c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C38H34N2O3S/c1-3-44-37(41)24-38(2,29-14-20-33(21-15-29)42-25-31-18-12-27-8-4-6-10-35(27)39-31)30-16-22-34(23-17-30)43-26-32-19-13-28-9-5-7-11-36(28)40-32/h4-23H,3,24-26H2,1-2H3 |
| InChIKey | JISBUUVDPMTJQI-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|