C21H21NNaO3 — CID 162335511
CID 162335511 (PubChem CID 162335511) has the molecular formula C21H21NNaO3 and a molecular weight of 358.39 g/mol.
| Compound Name | CID 162335511 |
|---|---|
| PubChem CID | 162335511 |
| Molecular Formula | C21H21NNaO3 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | — |
| SMILES | CCCCC(=O)Oc1ccc(OCc2ccc3ccccc3n2)cc1.[Na] |
| InChI | InChI=1S/C21H21NO3.Na/c1-2-3-8-21(23)25-19-13-11-18(12-14-19)24-15-17-10-9-16-6-4-5-7-20(16)22-17;/h4-7,9-14H,2-3,8,15H2,1H3; |
| InChIKey | NFUGHVPOSCBITD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|