C22H23NO3 — CID 143099066
[4-[(2-methylquinolin-4-yl)methoxy]phenyl] pentanoate (PubChem CID 143099066) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is [4-[(2-methylquinolin-4-yl)methoxy]phenyl] pentanoate.
| Compound Name | [4-[(2-methylquinolin-4-yl)methoxy]phenyl] pentanoate |
|---|---|
| PubChem CID | 143099066 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [4-[(2-methylquinolin-4-yl)methoxy]phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(OCc2cc(C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-3-4-9-22(24)26-19-12-10-18(11-13-19)25-15-17-14-16(2)23-21-8-6-5-7-20(17)21/h5-8,10-14H,3-4,9,15H2,1-2H3 |
| InChIKey | FURWLJJMZRHBRL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|