C16H13NO3S — CID 79234546
4-[(2-methylquinolin-4-yl)methoxy]thiophene-2-carboxylic acid (PubChem CID 79234546) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-[(2-methylquinolin-4-yl)methoxy]thiophene-2-carboxylic acid.
| Compound Name | 4-[(2-methylquinolin-4-yl)methoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79234546 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-[(2-methylquinolin-4-yl)methoxy]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(COc2csc(C(=O)O)c2)c2ccccc2n1 |
| InChI | InChI=1S/C16H13NO3S/c1-10-6-11(13-4-2-3-5-14(13)17-10)8-20-12-7-15(16(18)19)21-9-12/h2-7,9H,8H2,1H3,(H,18,19) |
| InChIKey | UDFOQEITKBBTTK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |